C22H27F3N2O3S — CID 71464436
4-[bis(2-methylpropyl)sulfamoyl]-N-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 71464436) has the molecular formula C22H27F3N2O3S and a molecular weight of 456.53 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)sulfamoyl]-N-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 71464436 |
| Molecular Formula | C22H27F3N2O3S |
| Molecular Weight | 456.53 g/mol |
| Exact Mass | 456.17 |
| IUPAC Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CC(C)CN(CC(C)C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H27F3N2O3S/c1-15(2)13-27(14-16(3)4)31(29,30)20-11-5-17(6-12-20)21(28)26-19-9-7-18(8-10-19)22(23,24)25/h5-12,15-16H,13-14H2,1-4H3,(H,26,28) |
| InChIKey | SMEUWXUGITTZTN-UHFFFAOYSA-N |
| XLogP | 5.26 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.53 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |