C18H28N2O5S — CID 17311755
ethyl 2-[4-[bis(2-methylpropyl)sulfamoyl]anilino]-2-oxoacetate (PubChem CID 17311755) has the molecular formula C18H28N2O5S and a molecular weight of 384.50 g/mol. Its IUPAC name is ethyl 2-[4-[bis(2-methylpropyl)sulfamoyl]anilino]-2-oxoacetate.
| Compound Name | ethyl 2-[4-[bis(2-methylpropyl)sulfamoyl]anilino]-2-oxoacetate |
|---|---|
| PubChem CID | 17311755 |
| Molecular Formula | C18H28N2O5S |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.17 |
| IUPAC Name | ethyl 2-[4-[bis(2-methylpropyl)sulfamoyl]anilino]-2-oxoacetate |
| SMILES | CCOC(=O)C(=O)Nc1ccc(S(=O)(=O)N(CC(C)C)CC(C)C)cc1 |
| InChI | InChI=1S/C18H28N2O5S/c1-6-25-18(22)17(21)19-15-7-9-16(10-8-15)26(23,24)20(11-13(2)3)12-14(4)5/h7-10,13-14H,6,11-12H2,1-5H3,(H,19,21) |
| InChIKey | FEKXMKBWTFVYFX-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|