C26H33N5O5S2 — CID 2147322
4-[bis(2-methylpropyl)sulfamoyl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]benzamide (PubChem CID 2147322) has the molecular formula C26H33N5O5S2 and a molecular weight of 559.71 g/mol. Its IUPAC name is 4-[bis(2-methylpropyl)sulfamoyl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 2147322 |
| Molecular Formula | C26H33N5O5S2 |
| Molecular Weight | 559.71 g/mol |
| Exact Mass | 559.19 |
| IUPAC Name | 4-[bis(2-methylpropyl)sulfamoyl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]benzamide |
| SMILES | Cc1ccnc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(S(=O)(=O)N(CC(C)C)CC(C)C)cc3)cc2)n1 |
| InChI | InChI=1S/C26H33N5O5S2/c1-18(2)16-31(17-19(3)4)38(35,36)24-10-6-21(7-11-24)25(32)29-22-8-12-23(13-9-22)37(33,34)30-26-27-15-14-20(5)28-26/h6-15,18-19H,16-17H2,1-5H3,(H,29,32)(H,27,28,30) |
| InChIKey | KLNHQZKYWKFNFV-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.71 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |