C24H25N5O5S2 — CID 2147353
4-[bis(prop-2-enyl)sulfamoyl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]benzamide (PubChem CID 2147353) has the molecular formula C24H25N5O5S2 and a molecular weight of 527.63 g/mol. Its IUPAC name is 4-[bis(prop-2-enyl)sulfamoyl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]benzamide.
| Compound Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]benzamide |
|---|---|
| PubChem CID | 2147353 |
| Molecular Formula | C24H25N5O5S2 |
| Molecular Weight | 527.63 g/mol |
| Exact Mass | 527.13 |
| IUPAC Name | 4-[bis(prop-2-enyl)sulfamoyl]-N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]benzamide |
| SMILES | C=CCN(CC=C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3nccc(C)n3)cc2)cc1 |
| InChI | InChI=1S/C24H25N5O5S2/c1-4-16-29(17-5-2)36(33,34)22-10-6-19(7-11-22)23(30)27-20-8-12-21(13-9-20)35(31,32)28-24-25-15-14-18(3)26-24/h4-15H,1-2,16-17H2,3H3,(H,27,30)(H,25,26,28) |
| InChIKey | SVXOJHPRARGMHU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.63 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|