C22H19N5O5S3 — CID 43908824
N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide (PubChem CID 43908824) has the molecular formula C22H19N5O5S3 and a molecular weight of 529.63 g/mol. Its IUPAC name is N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide.
| Compound Name | N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 43908824 |
| Molecular Formula | C22H19N5O5S3 |
| Molecular Weight | 529.63 g/mol |
| Exact Mass | 529.05 |
| IUPAC Name | N-[4-[(4-methylpyrimidin-2-yl)sulfamoyl]phenyl]-4-(thiophen-2-ylsulfonylamino)benzamide |
| SMILES | Cc1ccnc(NS(=O)(=O)c2ccc(NC(=O)c3ccc(NS(=O)(=O)c4cccs4)cc3)cc2)n1 |
| InChI | InChI=1S/C22H19N5O5S3/c1-15-12-13-23-22(24-15)27-34(29,30)19-10-8-17(9-11-19)25-21(28)16-4-6-18(7-5-16)26-35(31,32)20-3-2-14-33-20/h2-14,26H,1H3,(H,25,28)(H,23,24,27) |
| InChIKey | XQQIFFKXXRMGLV-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 147.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.63 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |