C19H19N5O5S2 — CID 4671821
4-(dimethylsulfamoyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 4671821) has the molecular formula C19H19N5O5S2 and a molecular weight of 461.53 g/mol. Its IUPAC name is 4-(dimethylsulfamoyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 4-(dimethylsulfamoyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 4671821 |
| Molecular Formula | C19H19N5O5S2 |
| Molecular Weight | 461.53 g/mol |
| Exact Mass | 461.08 |
| IUPAC Name | 4-(dimethylsulfamoyl)-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | CN(C)S(=O)(=O)c1ccc(C(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)cc1 |
| InChI | InChI=1S/C19H19N5O5S2/c1-24(2)31(28,29)17-8-4-14(5-9-17)18(25)22-15-6-10-16(11-7-15)30(26,27)23-19-20-12-3-13-21-19/h3-13H,1-2H3,(H,22,25)(H,20,21,23) |
| InChIKey | JWFLFIWMJMDLSK-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 138.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.53 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |