C19H18N4O3S — CID 2597997
3,5-dimethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 2597997) has the molecular formula C19H18N4O3S and a molecular weight of 382.45 g/mol. Its IUPAC name is 3,5-dimethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 3,5-dimethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2597997 |
| Molecular Formula | C19H18N4O3S |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.11 |
| IUPAC Name | 3,5-dimethyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | Cc1cc(C)cc(C(=O)Nc2ccc(S(=O)(=O)Nc3ncccn3)cc2)c1 |
| InChI | InChI=1S/C19H18N4O3S/c1-13-10-14(2)12-15(11-13)18(24)22-16-4-6-17(7-5-16)27(25,26)23-19-20-8-3-9-21-19/h3-12H,1-2H3,(H,22,24)(H,20,21,23) |
| InChIKey | RZZFRKRJKGSHNI-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |