C15H12N4O4S — CID 674488
N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-3-carboxamide (PubChem CID 674488) has the molecular formula C15H12N4O4S and a molecular weight of 344.35 g/mol. Its IUPAC name is N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-3-carboxamide.
| Compound Name | N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-3-carboxamide |
|---|---|
| PubChem CID | 674488 |
| Molecular Formula | C15H12N4O4S |
| Molecular Weight | 344.35 g/mol |
| Exact Mass | 344.06 |
| IUPAC Name | N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]furan-3-carboxamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1ccoc1 |
| InChI | InChI=1S/C15H12N4O4S/c20-14(11-6-9-23-10-11)18-12-2-4-13(5-3-12)24(21,22)19-15-16-7-1-8-17-15/h1-10H,(H,18,20)(H,16,17,19) |
| InChIKey | ZZWFDKDFRNZIFU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 114.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.35 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |