C24H20N4O3S — CID 4185684
2,2-diphenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide (PubChem CID 4185684) has the molecular formula C24H20N4O3S and a molecular weight of 444.52 g/mol. Its IUPAC name is 2,2-diphenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide.
| Compound Name | 2,2-diphenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
|---|---|
| PubChem CID | 4185684 |
| Molecular Formula | C24H20N4O3S |
| Molecular Weight | 444.52 g/mol |
| Exact Mass | 444.13 |
| IUPAC Name | 2,2-diphenyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]acetamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H20N4O3S/c29-23(22(18-8-3-1-4-9-18)19-10-5-2-6-11-19)27-20-12-14-21(15-13-20)32(30,31)28-24-25-16-7-17-26-24/h1-17,22H,(H,27,29)(H,25,26,28) |
| InChIKey | VNSHAEAQBWQFGC-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.52 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |