C24H20N4O3S2 — CID 92675622
2-benzylsulfanyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 92675622) has the molecular formula C24H20N4O3S2 and a molecular weight of 476.58 g/mol. Its IUPAC name is 2-benzylsulfanyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 2-benzylsulfanyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 92675622 |
| Molecular Formula | C24H20N4O3S2 |
| Molecular Weight | 476.58 g/mol |
| Exact Mass | 476.10 |
| IUPAC Name | 2-benzylsulfanyl-N-[4-(pyrimidin-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(S(=O)(=O)Nc2ncccn2)cc1)c1ccccc1SCc1ccccc1 |
| InChI | InChI=1S/C24H20N4O3S2/c29-23(21-9-4-5-10-22(21)32-17-18-7-2-1-3-8-18)27-19-11-13-20(14-12-19)33(30,31)28-24-25-15-6-16-26-24/h1-16H,17H2,(H,27,29)(H,25,26,28) |
| InChIKey | QEQVGRRLHAARFH-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.58 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |