C19H16ClN3OS — CID 11164561
2-[(2-amino-4-pyridinyl)methylsulfanyl]-N-(4-chlorophenyl)benzamide (PubChem CID 11164561) has the molecular formula C19H16ClN3OS and a molecular weight of 369.88 g/mol. Its IUPAC name is 2-[(2-amino-4-pyridinyl)methylsulfanyl]-N-(4-chlorophenyl)benzamide.
| Compound Name | 2-[(2-amino-4-pyridinyl)methylsulfanyl]-N-(4-chlorophenyl)benzamide |
|---|---|
| PubChem CID | 11164561 |
| Molecular Formula | C19H16ClN3OS |
| Molecular Weight | 369.88 g/mol |
| Exact Mass | 369.07 |
| IUPAC Name | 2-[(2-amino-4-pyridinyl)methylsulfanyl]-N-(4-chlorophenyl)benzamide |
| SMILES | Nc1cc(CSc2ccccc2C(=O)Nc2ccc(Cl)cc2)ccn1 |
| InChI | InChI=1S/C19H16ClN3OS/c20-14-5-7-15(8-6-14)23-19(24)16-3-1-2-4-17(16)25-12-13-9-10-22-18(21)11-13/h1-11H,12H2,(H2,21,22)(H,23,24) |
| InChIKey | XLXXSPUHVPMQCB-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.88 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |