C22H23N3OS — CID 68841427
2-[(2-amino-4-pyridinyl)methylsulfanyl]-N-(3-propan-2-ylphenyl)benzamide (PubChem CID 68841427) has the molecular formula C22H23N3OS and a molecular weight of 377.51 g/mol. Its IUPAC name is 2-[(2-amino-4-pyridinyl)methylsulfanyl]-N-(3-propan-2-ylphenyl)benzamide.
| Compound Name | 2-[(2-amino-4-pyridinyl)methylsulfanyl]-N-(3-propan-2-ylphenyl)benzamide |
|---|---|
| PubChem CID | 68841427 |
| Molecular Formula | C22H23N3OS |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.16 |
| IUPAC Name | 2-[(2-amino-4-pyridinyl)methylsulfanyl]-N-(3-propan-2-ylphenyl)benzamide |
| SMILES | CC(C)c1cccc(NC(=O)c2ccccc2SCc2ccnc(N)c2)c1 |
| InChI | InChI=1S/C22H23N3OS/c1-15(2)17-6-5-7-18(13-17)25-22(26)19-8-3-4-9-20(19)27-14-16-10-11-24-21(23)12-16/h3-13,15H,14H2,1-2H3,(H2,23,24)(H,25,26) |
| InChIKey | SEPCOPAGNAKRNZ-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 68.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |