C19H15BrN2OS — CID 23093858
N-(3-bromophenyl)-2-(pyridin-4-ylmethylsulfanyl)benzamide (PubChem CID 23093858) has the molecular formula C19H15BrN2OS and a molecular weight of 399.31 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-(pyridin-4-ylmethylsulfanyl)benzamide.
| Compound Name | N-(3-bromophenyl)-2-(pyridin-4-ylmethylsulfanyl)benzamide |
|---|---|
| PubChem CID | 23093858 |
| Molecular Formula | C19H15BrN2OS |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.01 |
| IUPAC Name | N-(3-bromophenyl)-2-(pyridin-4-ylmethylsulfanyl)benzamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1ccccc1SCc1ccncc1 |
| InChI | InChI=1S/C19H15BrN2OS/c20-15-4-3-5-16(12-15)22-19(23)17-6-1-2-7-18(17)24-13-14-8-10-21-11-9-14/h1-12H,13H2,(H,22,23) |
| InChIKey | DMAQSPNPDBVOES-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |