C18H18BrNO2S — CID 9042785
N-(3-bromophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide (PubChem CID 9042785) has the molecular formula C18H18BrNO2S and a molecular weight of 392.32 g/mol. Its IUPAC name is N-(3-bromophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide.
| Compound Name | N-(3-bromophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 9042785 |
| Molecular Formula | C18H18BrNO2S |
| Molecular Weight | 392.32 g/mol |
| Exact Mass | 391.02 |
| IUPAC Name | N-(3-bromophenyl)-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
| SMILES | O=C(Nc1cccc(Br)c1)c1ccccc1SC[C@H]1CCCO1 |
| InChI | InChI=1S/C18H18BrNO2S/c19-13-5-3-6-14(11-13)20-18(21)16-8-1-2-9-17(16)23-12-15-7-4-10-22-15/h1-3,5-6,8-9,11,15H,4,7,10,12H2,(H,20,21)/t15-/m1/s1 |
| InChIKey | GQDQOUNRMHUVSB-OAHLLOKOSA-N |
| XLogP | 4.97 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.32 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |