C24H30N2O2S — CID 9328245
N-[4-(azepan-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide (PubChem CID 9328245) has the molecular formula C24H30N2O2S and a molecular weight of 410.58 g/mol. Its IUPAC name is N-[4-(azepan-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide.
| Compound Name | N-[4-(azepan-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
|---|---|
| PubChem CID | 9328245 |
| Molecular Formula | C24H30N2O2S |
| Molecular Weight | 410.58 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | N-[4-(azepan-1-yl)phenyl]-2-[[(2R)-oxolan-2-yl]methylsulfanyl]benzamide |
| SMILES | O=C(Nc1ccc(N2CCCCCC2)cc1)c1ccccc1SC[C@H]1CCCO1 |
| InChI | InChI=1S/C24H30N2O2S/c27-24(22-9-3-4-10-23(22)29-18-21-8-7-17-28-21)25-19-11-13-20(14-12-19)26-15-5-1-2-6-16-26/h3-4,9-14,21H,1-2,5-8,15-18H2,(H,25,27)/t21-/m1/s1 |
| InChIKey | USSFCLHMIJHCDQ-OAQYLSRUSA-N |
| XLogP | 5.59 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.58 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|