C22H18F3N3O3S — CID 23150979
2-[(2-acetamido-4-pyridinyl)methylsulfanyl]-N-[4-(trifluoromethoxy)phenyl]benzamide (PubChem CID 23150979) has the molecular formula C22H18F3N3O3S and a molecular weight of 461.47 g/mol. Its IUPAC name is 2-[(2-acetamido-4-pyridinyl)methylsulfanyl]-N-[4-(trifluoromethoxy)phenyl]benzamide.
| Compound Name | 2-[(2-acetamido-4-pyridinyl)methylsulfanyl]-N-[4-(trifluoromethoxy)phenyl]benzamide |
|---|---|
| PubChem CID | 23150979 |
| Molecular Formula | C22H18F3N3O3S |
| Molecular Weight | 461.47 g/mol |
| Exact Mass | 461.10 |
| IUPAC Name | 2-[(2-acetamido-4-pyridinyl)methylsulfanyl]-N-[4-(trifluoromethoxy)phenyl]benzamide |
| SMILES | CC(=O)Nc1cc(CSc2ccccc2C(=O)Nc2ccc(OC(F)(F)F)cc2)ccn1 |
| InChI | InChI=1S/C22H18F3N3O3S/c1-14(29)27-20-12-15(10-11-26-20)13-32-19-5-3-2-4-18(19)21(30)28-16-6-8-17(9-7-16)31-22(23,24)25/h2-12H,13H2,1H3,(H,28,30)(H,26,27,29) |
| InChIKey | QVGSLRNRJPKDLB-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.47 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |