C19H13BrF3N3O2S — CID 10458018
2-[(2-bromo-4-pyridinyl)methylsulfanyl]-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide (PubChem CID 10458018) has the molecular formula C19H13BrF3N3O2S and a molecular weight of 484.30 g/mol. Its IUPAC name is 2-[(2-bromo-4-pyridinyl)methylsulfanyl]-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide.
| Compound Name | 2-[(2-bromo-4-pyridinyl)methylsulfanyl]-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 10458018 |
| Molecular Formula | C19H13BrF3N3O2S |
| Molecular Weight | 484.30 g/mol |
| Exact Mass | 482.99 |
| IUPAC Name | 2-[(2-bromo-4-pyridinyl)methylsulfanyl]-N-[4-(trifluoromethoxy)phenyl]pyridine-3-carboxamide |
| SMILES | O=C(Nc1ccc(OC(F)(F)F)cc1)c1cccnc1SCc1ccnc(Br)c1 |
| InChI | InChI=1S/C19H13BrF3N3O2S/c20-16-10-12(7-9-24-16)11-29-18-15(2-1-8-25-18)17(27)26-13-3-5-14(6-4-13)28-19(21,22)23/h1-10H,11H2,(H,26,27) |
| InChIKey | LOACWFRZUQIZGV-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.30 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|