C15H10F3N2O4S- — CID 2371854
2-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanylpyridine-3-carboxylate (PubChem CID 2371854) has the molecular formula C15H10F3N2O4S- and a molecular weight of 371.32 g/mol. Its IUPAC name is 2-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanylpyridine-3-carboxylate.
| Compound Name | 2-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanylpyridine-3-carboxylate |
|---|---|
| PubChem CID | 2371854 |
| Molecular Formula | C15H10F3N2O4S- |
| Molecular Weight | 371.32 g/mol |
| Exact Mass | 371.03 |
| IUPAC Name | 2-[2-oxo-2-[4-(trifluoromethoxy)anilino]ethyl]sulfanylpyridine-3-carboxylate |
| SMILES | O=C(CSc1ncccc1C(=O)[O-])Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H11F3N2O4S/c16-15(17,18)24-10-5-3-9(4-6-10)20-12(21)8-25-13-11(14(22)23)2-1-7-19-13/h1-7H,8H2,(H,20,21)(H,22,23)/p-1 |
| InChIKey | BYLOSMYJSGARSI-UHFFFAOYSA-M |
| XLogP | 2.07 |
| TPSA | 91.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.32 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |