C14H9F6N3O2S — CID 17024194
N-[4-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 17024194) has the molecular formula C14H9F6N3O2S and a molecular weight of 397.30 g/mol. Its IUPAC name is N-[4-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-[4-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 17024194 |
| Molecular Formula | C14H9F6N3O2S |
| Molecular Weight | 397.30 g/mol |
| Exact Mass | 397.03 |
| IUPAC Name | N-[4-(trifluoromethoxy)phenyl]-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nccc(C(F)(F)F)n1)Nc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H9F6N3O2S/c15-13(16,17)10-5-6-21-12(23-10)26-7-11(24)22-8-1-3-9(4-2-8)25-14(18,19)20/h1-6H,7H2,(H,22,24) |
| InChIKey | SZVKTOBBUBBTTH-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.30 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |