C17H17F3N4O2S — CID 36991749
N-propan-2-yl-2-[[2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetyl]amino]benzamide (PubChem CID 36991749) has the molecular formula C17H17F3N4O2S and a molecular weight of 398.41 g/mol. Its IUPAC name is N-propan-2-yl-2-[[2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetyl]amino]benzamide.
| Compound Name | N-propan-2-yl-2-[[2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetyl]amino]benzamide |
|---|---|
| PubChem CID | 36991749 |
| Molecular Formula | C17H17F3N4O2S |
| Molecular Weight | 398.41 g/mol |
| Exact Mass | 398.10 |
| IUPAC Name | N-propan-2-yl-2-[[2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetyl]amino]benzamide |
| SMILES | CC(C)NC(=O)c1ccccc1NC(=O)CSc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C17H17F3N4O2S/c1-10(2)22-15(26)11-5-3-4-6-12(11)23-14(25)9-27-16-21-8-7-13(24-16)17(18,19)20/h3-8,10H,9H2,1-2H3,(H,22,26)(H,23,25) |
| InChIKey | ZVBVYXPBQUZBHM-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 83.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.41 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |