C14H11ClF3N3OS — CID 46519126
N-(3-chloro-2-methylphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 46519126) has the molecular formula C14H11ClF3N3OS and a molecular weight of 361.78 g/mol. Its IUPAC name is N-(3-chloro-2-methylphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-(3-chloro-2-methylphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 46519126 |
| Molecular Formula | C14H11ClF3N3OS |
| Molecular Weight | 361.78 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | N-(3-chloro-2-methylphenyl)-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | Cc1c(Cl)cccc1NC(=O)CSc1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C14H11ClF3N3OS/c1-8-9(15)3-2-4-10(8)20-12(22)7-23-13-19-6-5-11(21-13)14(16,17)18/h2-6H,7H2,1H3,(H,20,22) |
| InChIKey | ROVHOFYTJJFFAX-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.78 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |