C14H12F3N3OS — CID 18158484
N-benzyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide (PubChem CID 18158484) has the molecular formula C14H12F3N3OS and a molecular weight of 327.33 g/mol. Its IUPAC name is N-benzyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide.
| Compound Name | N-benzyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
|---|---|
| PubChem CID | 18158484 |
| Molecular Formula | C14H12F3N3OS |
| Molecular Weight | 327.33 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | N-benzyl-2-[4-(trifluoromethyl)pyrimidin-2-yl]sulfanylacetamide |
| SMILES | O=C(CSc1nccc(C(F)(F)F)n1)NCc1ccccc1 |
| InChI | InChI=1S/C14H12F3N3OS/c15-14(16,17)11-6-7-18-13(20-11)22-9-12(21)19-8-10-4-2-1-3-5-10/h1-7H,8-9H2,(H,19,21) |
| InChIKey | RZCMVMBZMPWIJV-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.33 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |