C25H27FN4OS — CID 53142275
2-[4-(4-benzylpiperidin-1-yl)pyrimidin-2-yl]sulfanyl-N-[(4-fluorophenyl)methyl]acetamide (PubChem CID 53142275) has the molecular formula C25H27FN4OS and a molecular weight of 450.58 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperidin-1-yl)pyrimidin-2-yl]sulfanyl-N-[(4-fluorophenyl)methyl]acetamide.
| Compound Name | 2-[4-(4-benzylpiperidin-1-yl)pyrimidin-2-yl]sulfanyl-N-[(4-fluorophenyl)methyl]acetamide |
|---|---|
| PubChem CID | 53142275 |
| Molecular Formula | C25H27FN4OS |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.19 |
| IUPAC Name | 2-[4-(4-benzylpiperidin-1-yl)pyrimidin-2-yl]sulfanyl-N-[(4-fluorophenyl)methyl]acetamide |
| SMILES | O=C(CSc1nccc(N2CCC(Cc3ccccc3)CC2)n1)NCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H27FN4OS/c26-22-8-6-21(7-9-22)17-28-24(31)18-32-25-27-13-10-23(29-25)30-14-11-20(12-15-30)16-19-4-2-1-3-5-19/h1-10,13,20H,11-12,14-18H2,(H,28,31) |
| InChIKey | RTKBVAWWXFFKIB-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |