C20H23FN2S — CID 17298095
4-benzyl-N-[(4-fluorophenyl)methyl]piperidine-1-carbothioamide (PubChem CID 17298095) has the molecular formula C20H23FN2S and a molecular weight of 342.48 g/mol. Its IUPAC name is 4-benzyl-N-[(4-fluorophenyl)methyl]piperidine-1-carbothioamide.
| Compound Name | 4-benzyl-N-[(4-fluorophenyl)methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 17298095 |
| Molecular Formula | C20H23FN2S |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.16 |
| IUPAC Name | 4-benzyl-N-[(4-fluorophenyl)methyl]piperidine-1-carbothioamide |
| SMILES | Fc1ccc(CNC(=S)N2CCC(Cc3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C20H23FN2S/c21-19-8-6-18(7-9-19)15-22-20(24)23-12-10-17(11-13-23)14-16-4-2-1-3-5-16/h1-9,17H,10-15H2,(H,22,24) |
| InChIKey | XEJUOZMWURUGBN-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|