C13H17FN2S — CID 19653683
N-[(4-fluorophenyl)methyl]piperidine-1-carbothioamide (PubChem CID 19653683) has the molecular formula C13H17FN2S and a molecular weight of 252.36 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]piperidine-1-carbothioamide.
| Compound Name | N-[(4-fluorophenyl)methyl]piperidine-1-carbothioamide |
|---|---|
| PubChem CID | 19653683 |
| Molecular Formula | C13H17FN2S |
| Molecular Weight | 252.36 g/mol |
| Exact Mass | 252.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]piperidine-1-carbothioamide |
| SMILES | Fc1ccc(CNC(=S)N2CCCCC2)cc1 |
| InChI | InChI=1S/C13H17FN2S/c14-12-6-4-11(5-7-12)10-15-13(17)16-8-2-1-3-9-16/h4-7H,1-3,8-10H2,(H,15,17) |
| InChIKey | ZTSDJQXAVVFFIX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.36 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|