C17H20FN3S2 — CID 8565034
N-[(4-fluorophenyl)methyl]-4-(thiophen-3-ylmethyl)piperazine-1-carbothioamide (PubChem CID 8565034) has the molecular formula C17H20FN3S2 and a molecular weight of 349.50 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-4-(thiophen-3-ylmethyl)piperazine-1-carbothioamide.
| Compound Name | N-[(4-fluorophenyl)methyl]-4-(thiophen-3-ylmethyl)piperazine-1-carbothioamide |
|---|---|
| PubChem CID | 8565034 |
| Molecular Formula | C17H20FN3S2 |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-4-(thiophen-3-ylmethyl)piperazine-1-carbothioamide |
| SMILES | Fc1ccc(CNC(=S)N2CCN(Cc3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C17H20FN3S2/c18-16-3-1-14(2-4-16)11-19-17(22)21-8-6-20(7-9-21)12-15-5-10-23-13-15/h1-5,10,13H,6-9,11-12H2,(H,19,22) |
| InChIKey | DHNYBJYXDAYIAE-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|