C15H16FNS — CID 95869700
(3S)-3-(4-fluorophenyl)-1-(thiophen-3-ylmethyl)pyrrolidine (PubChem CID 95869700) has the molecular formula C15H16FNS and a molecular weight of 261.37 g/mol. Its IUPAC name is (3S)-3-(4-fluorophenyl)-1-(thiophen-3-ylmethyl)pyrrolidine.
| Compound Name | (3S)-3-(4-fluorophenyl)-1-(thiophen-3-ylmethyl)pyrrolidine |
|---|---|
| PubChem CID | 95869700 |
| Molecular Formula | C15H16FNS |
| Molecular Weight | 261.37 g/mol |
| Exact Mass | 261.10 |
| IUPAC Name | (3S)-3-(4-fluorophenyl)-1-(thiophen-3-ylmethyl)pyrrolidine |
| SMILES | Fc1ccc([C@@H]2CCN(Cc3ccsc3)C2)cc1 |
| InChI | InChI=1S/C15H16FNS/c16-15-3-1-13(2-4-15)14-5-7-17(10-14)9-12-6-8-18-11-12/h1-4,6,8,11,14H,5,7,9-10H2/t14-/m1/s1 |
| InChIKey | MZSIFJPAYOCIJZ-CQSZACIVSA-N |
| XLogP | 3.88 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.37 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |