C10H16N2S — CID 62068989
[1-(thiophen-3-ylmethyl)pyrrolidin-3-yl]methanamine (PubChem CID 62068989) has the molecular formula C10H16N2S and a molecular weight of 196.32 g/mol. Its IUPAC name is [1-(thiophen-3-ylmethyl)pyrrolidin-3-yl]methanamine.
| Compound Name | [1-(thiophen-3-ylmethyl)pyrrolidin-3-yl]methanamine |
|---|---|
| PubChem CID | 62068989 |
| Molecular Formula | C10H16N2S |
| Molecular Weight | 196.32 g/mol |
| Exact Mass | 196.10 |
| IUPAC Name | [1-(thiophen-3-ylmethyl)pyrrolidin-3-yl]methanamine |
| SMILES | NCC1CCN(Cc2ccsc2)C1 |
| InChI | InChI=1S/C10H16N2S/c11-5-9-1-3-12(6-9)7-10-2-4-13-8-10/h2,4,8-9H,1,3,5-7,11H2 |
| InChIKey | UETYSGDEFLAFKV-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.32 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |