C9H13NOS — CID 62916311
1-(thiophen-3-ylmethyl)pyrrolidin-3-ol (PubChem CID 62916311) has the molecular formula C9H13NOS and a molecular weight of 183.28 g/mol. Its IUPAC name is 1-(thiophen-3-ylmethyl)pyrrolidin-3-ol.
| Compound Name | 1-(thiophen-3-ylmethyl)pyrrolidin-3-ol |
|---|---|
| PubChem CID | 62916311 |
| Molecular Formula | C9H13NOS |
| Molecular Weight | 183.28 g/mol |
| Exact Mass | 183.07 |
| IUPAC Name | 1-(thiophen-3-ylmethyl)pyrrolidin-3-ol |
| SMILES | OC1CCN(Cc2ccsc2)C1 |
| InChI | InChI=1S/C9H13NOS/c11-9-1-3-10(6-9)5-8-2-4-12-7-8/h2,4,7,9,11H,1,3,5-6H2 |
| InChIKey | BHMHVXFXSKDSGO-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.28 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |