C16H25N3O2S — CID 94382593
2-[(3S)-3-hydroxypiperidin-1-yl]-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 94382593) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is 2-[(3S)-3-hydroxypiperidin-1-yl]-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-[(3S)-3-hydroxypiperidin-1-yl]-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 94382593 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | 2-[(3S)-3-hydroxypiperidin-1-yl]-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | O=C(CN1CCC[C@H](O)C1)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C16H25N3O2S/c20-15-2-1-4-18(11-15)12-16(21)19-7-5-17(6-8-19)10-14-3-9-22-13-14/h3,9,13,15,20H,1-2,4-8,10-12H2/t15-/m0/s1 |
| InChIKey | LTILSCVNBUPWRO-HNNXBMFYSA-N |
| XLogP | 0.85 |
| TPSA | 47.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |