C19H31N3OS2 — CID 86938987
2-(3-ethylsulfanylazepan-1-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone (PubChem CID 86938987) has the molecular formula C19H31N3OS2 and a molecular weight of 381.61 g/mol. Its IUPAC name is 2-(3-ethylsulfanylazepan-1-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone.
| Compound Name | 2-(3-ethylsulfanylazepan-1-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 86938987 |
| Molecular Formula | C19H31N3OS2 |
| Molecular Weight | 381.61 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | 2-(3-ethylsulfanylazepan-1-yl)-1-[4-(thiophen-3-ylmethyl)piperazin-1-yl]ethanone |
| SMILES | CCSC1CCCCN(CC(=O)N2CCN(Cc3ccsc3)CC2)C1 |
| InChI | InChI=1S/C19H31N3OS2/c1-2-25-18-5-3-4-7-21(14-18)15-19(23)22-10-8-20(9-11-22)13-17-6-12-24-16-17/h6,12,16,18H,2-5,7-11,13-15H2,1H3 |
| InChIKey | XXVMTTGHWWSDIC-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.61 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |