C12H18N2O2S — CID 30981151
ethyl 4-(thiophen-3-ylmethyl)piperazine-1-carboxylate (PubChem CID 30981151) has the molecular formula C12H18N2O2S and a molecular weight of 254.35 g/mol. Its IUPAC name is ethyl 4-(thiophen-3-ylmethyl)piperazine-1-carboxylate.
| Compound Name | ethyl 4-(thiophen-3-ylmethyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 30981151 |
| Molecular Formula | C12H18N2O2S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.11 |
| IUPAC Name | ethyl 4-(thiophen-3-ylmethyl)piperazine-1-carboxylate |
| SMILES | CCOC(=O)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C12H18N2O2S/c1-2-16-12(15)14-6-4-13(5-7-14)9-11-3-8-17-10-11/h3,8,10H,2,4-7,9H2,1H3 |
| InChIKey | AKWZNPUYMFDHBD-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |