C18H22N4O2S — CID 17412335
N'-(4-methylbenzoyl)-4-(thiophen-3-ylmethyl)piperazine-1-carbohydrazide (PubChem CID 17412335) has the molecular formula C18H22N4O2S and a molecular weight of 358.47 g/mol. Its IUPAC name is N'-(4-methylbenzoyl)-4-(thiophen-3-ylmethyl)piperazine-1-carbohydrazide.
| Compound Name | N'-(4-methylbenzoyl)-4-(thiophen-3-ylmethyl)piperazine-1-carbohydrazide |
|---|---|
| PubChem CID | 17412335 |
| Molecular Formula | C18H22N4O2S |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | N'-(4-methylbenzoyl)-4-(thiophen-3-ylmethyl)piperazine-1-carbohydrazide |
| SMILES | Cc1ccc(C(=O)NNC(=O)N2CCN(Cc3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C18H22N4O2S/c1-14-2-4-16(5-3-14)17(23)19-20-18(24)22-9-7-21(8-10-22)12-15-6-11-25-13-15/h2-6,11,13H,7-10,12H2,1H3,(H,19,23)(H,20,24) |
| InChIKey | QXMNYTUBVPCZPK-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 64.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|