C23H27N3OS — CID 3788667
[4-(2,5-dimethylpyrrol-1-yl)phenyl]-[4-(thiophen-3-ylmethyl)-1,4-diazepan-1-yl]methanone (PubChem CID 3788667) has the molecular formula C23H27N3OS and a molecular weight of 393.56 g/mol. Its IUPAC name is [4-(2,5-dimethylpyrrol-1-yl)phenyl]-[4-(thiophen-3-ylmethyl)-1,4-diazepan-1-yl]methanone.
| Compound Name | [4-(2,5-dimethylpyrrol-1-yl)phenyl]-[4-(thiophen-3-ylmethyl)-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 3788667 |
| Molecular Formula | C23H27N3OS |
| Molecular Weight | 393.56 g/mol |
| Exact Mass | 393.19 |
| IUPAC Name | [4-(2,5-dimethylpyrrol-1-yl)phenyl]-[4-(thiophen-3-ylmethyl)-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)N2CCCN(Cc3ccsc3)CC2)cc1 |
| InChI | InChI=1S/C23H27N3OS/c1-18-4-5-19(2)26(18)22-8-6-21(7-9-22)23(27)25-12-3-11-24(13-14-25)16-20-10-15-28-17-20/h4-10,15,17H,3,11-14,16H2,1-2H3 |
| InChIKey | XRMWMSFXOBTUQB-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 28.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'} |
|---|