C13H16N4OS — CID 60786486
1H-pyrazol-4-yl-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone (PubChem CID 60786486) has the molecular formula C13H16N4OS and a molecular weight of 276.36 g/mol. Its IUPAC name is 1H-pyrazol-4-yl-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone.
| Compound Name | 1H-pyrazol-4-yl-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 60786486 |
| Molecular Formula | C13H16N4OS |
| Molecular Weight | 276.36 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 1H-pyrazol-4-yl-[4-(thiophen-3-ylmethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cn[nH]c1)N1CCN(Cc2ccsc2)CC1 |
| InChI | InChI=1S/C13H16N4OS/c18-13(12-7-14-15-8-12)17-4-2-16(3-5-17)9-11-1-6-19-10-11/h1,6-8,10H,2-5,9H2,(H,14,15) |
| InChIKey | PKZHFQKJPCDNGW-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |