About 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone
1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone (PubChem CID 60786982) has the molecular formula C10H13F3N4O
and a molecular weight of 262.23 g/mol. Its IUPAC name is 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone.
Molecular Properties
| Compound Name | 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
| PubChem CID | 60786982 |
| Molecular Formula | C10H13F3N4O |
| Molecular Weight | 262.23 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cn[nH]c1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C10H13F3N4O/c11-10(12,13)7-16-1-3-17(4-2-16)9(18)8-5-14-15-6-8/h5-6H,1-4,7H2,(H,14,15) |
| InChIKey | FLTCAQABBXFAQE-UHFFFAOYSA-N |
| XLogP | 0.73 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.23 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone?
The IUPAC name of 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone (CID 60786982) is 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone.
What is the SMILES notation for 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone?
The canonical SMILES for 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone is O=C(c1cn[nH]c1)N1CCN(CC(F)(F)F)CC1.
What is the InChIKey of 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone?
The InChIKey is FLTCAQABBXFAQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13F3N4O/c11-10(12,13)7-16-1-3-17(4-2-16)9(18)8-5-14-15-6-8/h5-6H,1-4,7H2,(H,14,15).
What are the key properties of 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone?
1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone has a molecular weight of 262.23 g/mol, XLogP of 0.73, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1H-pyrazol-4-yl-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone is sourced from PubChem (CID 60786982), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).