C11H17BrN4O — CID 80665317
[4-(2-bromoethyl)-1,4-diazepan-1-yl]-(1H-pyrazol-4-yl)methanone (PubChem CID 80665317) has the molecular formula C11H17BrN4O and a molecular weight of 301.19 g/mol. Its IUPAC name is [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(1H-pyrazol-4-yl)methanone.
| Compound Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(1H-pyrazol-4-yl)methanone |
|---|---|
| PubChem CID | 80665317 |
| Molecular Formula | C11H17BrN4O |
| Molecular Weight | 301.19 g/mol |
| Exact Mass | 300.06 |
| IUPAC Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(1H-pyrazol-4-yl)methanone |
| SMILES | O=C(c1cn[nH]c1)N1CCCN(CCBr)CC1 |
| InChI | InChI=1S/C11H17BrN4O/c12-2-5-15-3-1-4-16(7-6-15)11(17)10-8-13-14-9-10/h8-9H,1-7H2,(H,13,14) |
| InChIKey | PPVXKVKEVOGGSX-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 52.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.19 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|