C16H23BrN2O — CID 80665931
[4-(2-bromoethyl)-1,4-diazepan-1-yl]-(3,5-dimethylphenyl)methanone (PubChem CID 80665931) has the molecular formula C16H23BrN2O and a molecular weight of 339.28 g/mol. Its IUPAC name is [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(3,5-dimethylphenyl)methanone.
| Compound Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(3,5-dimethylphenyl)methanone |
|---|---|
| PubChem CID | 80665931 |
| Molecular Formula | C16H23BrN2O |
| Molecular Weight | 339.28 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(3,5-dimethylphenyl)methanone |
| SMILES | Cc1cc(C)cc(C(=O)N2CCCN(CCBr)CC2)c1 |
| InChI | InChI=1S/C16H23BrN2O/c1-13-10-14(2)12-15(11-13)16(20)19-6-3-5-18(7-4-17)8-9-19/h10-12H,3-9H2,1-2H3 |
| InChIKey | DNDNGNWGTUPATM-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.28 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|