C13H18BrN3O — CID 106754168
[4-(2-bromoethyl)piperazin-1-yl]-(2-methyl-4-pyridinyl)methanone (PubChem CID 106754168) has the molecular formula C13H18BrN3O and a molecular weight of 312.21 g/mol. Its IUPAC name is [4-(2-bromoethyl)piperazin-1-yl]-(2-methyl-4-pyridinyl)methanone.
| Compound Name | [4-(2-bromoethyl)piperazin-1-yl]-(2-methyl-4-pyridinyl)methanone |
|---|---|
| PubChem CID | 106754168 |
| Molecular Formula | C13H18BrN3O |
| Molecular Weight | 312.21 g/mol |
| Exact Mass | 311.06 |
| IUPAC Name | [4-(2-bromoethyl)piperazin-1-yl]-(2-methyl-4-pyridinyl)methanone |
| SMILES | Cc1cc(C(=O)N2CCN(CCBr)CC2)ccn1 |
| InChI | InChI=1S/C13H18BrN3O/c1-11-10-12(2-4-15-11)13(18)17-8-6-16(5-3-14)7-9-17/h2,4,10H,3,5-9H2,1H3 |
| InChIKey | ZFOSXSHCXXFFCJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.21 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|