C14H18BrIN2O — CID 80666361
[4-(2-bromoethyl)-1,4-diazepan-1-yl]-(3-iodophenyl)methanone (PubChem CID 80666361) has the molecular formula C14H18BrIN2O and a molecular weight of 437.12 g/mol. Its IUPAC name is [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(3-iodophenyl)methanone.
| Compound Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 80666361 |
| Molecular Formula | C14H18BrIN2O |
| Molecular Weight | 437.12 g/mol |
| Exact Mass | 435.96 |
| IUPAC Name | [4-(2-bromoethyl)-1,4-diazepan-1-yl]-(3-iodophenyl)methanone |
| SMILES | O=C(c1cccc(I)c1)N1CCCN(CCBr)CC1 |
| InChI | InChI=1S/C14H18BrIN2O/c15-5-8-17-6-2-7-18(10-9-17)14(19)12-3-1-4-13(16)11-12/h1,3-4,11H,2,5-10H2 |
| InChIKey | FVGKJVGTNSRXBI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.12 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|