C20H26IN3OS — CID 95752516
[4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]-(3-iodophenyl)methanone (PubChem CID 95752516) has the molecular formula C20H26IN3OS and a molecular weight of 483.42 g/mol. Its IUPAC name is [4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]-(3-iodophenyl)methanone.
| Compound Name | [4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]-(3-iodophenyl)methanone |
|---|---|
| PubChem CID | 95752516 |
| Molecular Formula | C20H26IN3OS |
| Molecular Weight | 483.42 g/mol |
| Exact Mass | 483.08 |
| IUPAC Name | [4-[(2-tert-butyl-1,3-thiazol-4-yl)methyl]-1,4-diazepan-1-yl]-(3-iodophenyl)methanone |
| SMILES | CC(C)(C)c1nc(CN2CCCN(C(=O)c3cccc(I)c3)CC2)cs1 |
| InChI | InChI=1S/C20H26IN3OS/c1-20(2,3)19-22-17(14-26-19)13-23-8-5-9-24(11-10-23)18(25)15-6-4-7-16(21)12-15/h4,6-7,12,14H,5,8-11,13H2,1-3H3 |
| InChIKey | GEPBIRFFUIWREK-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.42 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|