C12H13F4N3O — CID 63979493
(6-fluoro-3-pyridinyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone (PubChem CID 63979493) has the molecular formula C12H13F4N3O and a molecular weight of 291.25 g/mol. Its IUPAC name is (6-fluoro-3-pyridinyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone.
| Compound Name | (6-fluoro-3-pyridinyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 63979493 |
| Molecular Formula | C12H13F4N3O |
| Molecular Weight | 291.25 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (6-fluoro-3-pyridinyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(F)nc1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H13F4N3O/c13-10-2-1-9(7-17-10)11(20)19-5-3-18(4-6-19)8-12(14,15)16/h1-2,7H,3-6,8H2 |
| InChIKey | WKEBVWWLQRRBTJ-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 36.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.25 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|