C15H15F6IN2O2 — CID 172647602
[3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone (PubChem CID 172647602) has the molecular formula C15H15F6IN2O2 and a molecular weight of 496.19 g/mol. Its IUPAC name is [3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone.
| Compound Name | [3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 172647602 |
| Molecular Formula | C15H15F6IN2O2 |
| Molecular Weight | 496.19 g/mol |
| Exact Mass | 496.01 |
| IUPAC Name | [3-iodo-4-(2,2,2-trifluoroethoxy)phenyl]-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1ccc(OCC(F)(F)F)c(I)c1)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H15F6IN2O2/c16-14(17,18)8-23-3-5-24(6-4-23)13(25)10-1-2-12(11(22)7-10)26-9-15(19,20)21/h1-2,7H,3-6,8-9H2 |
| InChIKey | OQKWNSBCHAJRIS-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.19 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|