C13H13BrF3IN2O — CID 171921460
(2-bromo-3-iodophenyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone (PubChem CID 171921460) has the molecular formula C13H13BrF3IN2O and a molecular weight of 477.06 g/mol. Its IUPAC name is (2-bromo-3-iodophenyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone.
| Compound Name | (2-bromo-3-iodophenyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 171921460 |
| Molecular Formula | C13H13BrF3IN2O |
| Molecular Weight | 477.06 g/mol |
| Exact Mass | 475.92 |
| IUPAC Name | (2-bromo-3-iodophenyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cccc(I)c1Br)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H13BrF3IN2O/c14-11-9(2-1-3-10(11)18)12(21)20-6-4-19(5-7-20)8-13(15,16)17/h1-3H,4-8H2 |
| InChIKey | NXUFTSCSQLMKGS-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.06 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|