C13H14F3IN2O2 — CID 103606815
(2-hydroxy-5-iodophenyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone (PubChem CID 103606815) has the molecular formula C13H14F3IN2O2 and a molecular weight of 414.17 g/mol. Its IUPAC name is (2-hydroxy-5-iodophenyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone.
| Compound Name | (2-hydroxy-5-iodophenyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 103606815 |
| Molecular Formula | C13H14F3IN2O2 |
| Molecular Weight | 414.17 g/mol |
| Exact Mass | 414.01 |
| IUPAC Name | (2-hydroxy-5-iodophenyl)-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]methanone |
| SMILES | O=C(c1cc(I)ccc1O)N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C13H14F3IN2O2/c14-13(15,16)8-18-3-5-19(6-4-18)12(21)10-7-9(17)1-2-11(10)20/h1-2,7,20H,3-6,8H2 |
| InChIKey | NPDHEDJTDYAPAA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.17 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|