C16H21IN2O4 — CID 31121968
tert-butyl 4-(2-hydroxy-5-iodobenzoyl)piperazine-1-carboxylate (PubChem CID 31121968) has the molecular formula C16H21IN2O4 and a molecular weight of 432.26 g/mol. Its IUPAC name is tert-butyl 4-(2-hydroxy-5-iodobenzoyl)piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-(2-hydroxy-5-iodobenzoyl)piperazine-1-carboxylate |
|---|---|
| PubChem CID | 31121968 |
| Molecular Formula | C16H21IN2O4 |
| Molecular Weight | 432.26 g/mol |
| Exact Mass | 432.05 |
| IUPAC Name | tert-butyl 4-(2-hydroxy-5-iodobenzoyl)piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C(=O)c2cc(I)ccc2O)CC1 |
| InChI | InChI=1S/C16H21IN2O4/c1-16(2,3)23-15(22)19-8-6-18(7-9-19)14(21)12-10-11(17)4-5-13(12)20/h4-5,10,20H,6-9H2,1-3H3 |
| InChIKey | ARGZBEVQUNZXFJ-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.26 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|