C14H18INO2 — CID 67006732
tert-butyl 7-iodo-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 67006732) has the molecular formula C14H18INO2 and a molecular weight of 359.21 g/mol. Its IUPAC name is tert-butyl 7-iodo-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 7-iodo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 67006732 |
| Molecular Formula | C14H18INO2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | tert-butyl 7-iodo-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2ccc(I)cc2C1 |
| InChI | InChI=1S/C14H18INO2/c1-14(2,3)18-13(17)16-7-6-10-4-5-12(15)8-11(10)9-16/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | CQPIZUXOIVJXEH-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|