C16H24N2O2 — CID 139461216
tert-butyl 7-(dimethylamino)-3,4-dihydro-1H-isoquinoline-2-carboxylate (PubChem CID 139461216) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is tert-butyl 7-(dimethylamino)-3,4-dihydro-1H-isoquinoline-2-carboxylate.
| Compound Name | tert-butyl 7-(dimethylamino)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
|---|---|
| PubChem CID | 139461216 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | tert-butyl 7-(dimethylamino)-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| SMILES | CN(C)c1ccc2c(c1)CN(C(=O)OC(C)(C)C)CC2 |
| InChI | InChI=1S/C16H24N2O2/c1-16(2,3)20-15(19)18-9-8-12-6-7-14(17(4)5)10-13(12)11-18/h6-7,10H,8-9,11H2,1-5H3 |
| InChIKey | PIHVPJJGFNPSNZ-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 32.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|