C16H22IN3O3 — CID 86633425
tert-butyl 4-(4-iodopyridine-2-carbonyl)-1,4-diazepane-1-carboxylate (PubChem CID 86633425) has the molecular formula C16H22IN3O3 and a molecular weight of 431.27 g/mol. Its IUPAC name is tert-butyl 4-(4-iodopyridine-2-carbonyl)-1,4-diazepane-1-carboxylate.
| Compound Name | tert-butyl 4-(4-iodopyridine-2-carbonyl)-1,4-diazepane-1-carboxylate |
|---|---|
| PubChem CID | 86633425 |
| Molecular Formula | C16H22IN3O3 |
| Molecular Weight | 431.27 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | tert-butyl 4-(4-iodopyridine-2-carbonyl)-1,4-diazepane-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCN(C(=O)c2cc(I)ccn2)CC1 |
| InChI | InChI=1S/C16H22IN3O3/c1-16(2,3)23-15(22)20-8-4-7-19(9-10-20)14(21)13-11-12(17)5-6-18-13/h5-6,11H,4,7-10H2,1-3H3 |
| InChIKey | MOXIMMZBRFXZHC-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.27 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|