C14H18INO2 — CID 113254113
(2-hydroxy-5-iodophenyl)-(3-propan-2-ylpyrrolidin-1-yl)methanone (PubChem CID 113254113) has the molecular formula C14H18INO2 and a molecular weight of 359.21 g/mol. Its IUPAC name is (2-hydroxy-5-iodophenyl)-(3-propan-2-ylpyrrolidin-1-yl)methanone.
| Compound Name | (2-hydroxy-5-iodophenyl)-(3-propan-2-ylpyrrolidin-1-yl)methanone |
|---|---|
| PubChem CID | 113254113 |
| Molecular Formula | C14H18INO2 |
| Molecular Weight | 359.21 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | (2-hydroxy-5-iodophenyl)-(3-propan-2-ylpyrrolidin-1-yl)methanone |
| SMILES | CC(C)C1CCN(C(=O)c2cc(I)ccc2O)C1 |
| InChI | InChI=1S/C14H18INO2/c1-9(2)10-5-6-16(8-10)14(18)12-7-11(15)3-4-13(12)17/h3-4,7,9-10,17H,5-6,8H2,1-2H3 |
| InChIKey | INCAOZPFIFSNLI-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.21 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|